About lab
Multi-model lab with an embedded visualisation sibling for Boltz-2 affinity-focused protein-ligand predictions. Ships with a real protein/ligand pair so the lab runs out of the box on a GPU runner.
Runtime
Duration0.01
Comms Step0.01
Settle Steps1
Runs
Total1
Completed1
Failed0
Metadata
Packageboltz-boltz2-affinity-predictor
Created2026-05-03
Updated2026-06-13
dockingboltzstructural-biologyprotein-ligandaffinitygpuvisualisationother
Manifest
{
"io": {
"inputs": [
{
"ui": {
"rows": 6,
"control": "textarea"
},
"name": "protein_sequence",
"label": "Target Protein Sequence",
"format": "sequence",
"maps_to": "boltz_boltz2_affinity_predictor.protein_sequence",
"required": false,
"value_type": "string",
"description": "Amino-acid sequence passed directly to the Boltz-2 protein input."
},
{
"ui": {
"rows": 3,
"control": "textarea"
},
"name": "ligand_smiles",
"label": "Ligand SMILES",
"format": "smiles",
"maps_to": "boltz_boltz2_affinity_predictor.ligand_smiles",
"required": false,
"value_type": "string",
"description": "Ligand structure encoded as a SMILES string and passed directly to Boltz-2."
},
{
"ui": {
"control": "file"
},
"file": {
"accept": [
".a3m",
".fasta",
".fa"
]
},
"name": "msa_path",
"label": "Precomputed MSA Path",
"format": "a3m",
"maps_to": "boltz_boltz2_affinity_predictor.msa_path",
"required": false,
"value_type": "file",
"description": "Optional path to a precomputed MSA file; leave unset when the MSA server is used."
},
{
"name": "use_msa_server",
"label": "Use MSA Server",
"default": true,
"maps_to": "boltz_boltz2_affinity_predictor.run_options.use_msa_server",
"value_type": "boolean",
"description": "Use Boltz's MSA server instead of requiring a precomputed MSA file."
},
{
"name": "sampling_steps",
"label": "Sampling Steps",
"default": 200,
"maps_to": "boltz_boltz2_affinity_predictor.run_options.sampling_steps",
"value_type": "integer",
"description": "Number of Boltz sampling steps for structure generation."
},
{
"name": "recycling_steps",
"label": "Recycling Steps",
"default": 3,
"maps_to": "boltz_boltz2_affinity_predictor.run_options.recycling_steps",
"value_type": "integer",
"description": "Number of structure recycling steps."
},
{
"name": "diffusion_samples",
"label": "Diffusion Samples",
"default": 1,
"maps_to": "boltz_boltz2_affinity_predictor.run_options.diffusion_samples",
"value_type": "integer",
"description": "Number of Boltz diffusion samples to generate."
},
{
"name": "output_format",
"label": "Output Format",
"default": "mmcif",
"maps_to": "boltz_boltz2_affinity_predictor.run_options.output_format",
"value_type": "string",
"description": "Structure artifact format emitted by Boltz.",
"allowed_values": [
"mmcif",
"pdb"
]
},
{
"ui": {
"rows": 6,
"control": "json"
},
"name": "run_options",
"label": "Boltz Run Options",
"format": "json",
"maps_to": "boltz_boltz2_affinity_predictor.run_options",
"advanced": true,
"required": false,
"value_type": "record",
"description": "Optional structured Boltz workflow controls such as MSA-server use, output format, and sampling settings."
}
],
"outputs": [
{
"name": "affinity_summary",
"label": "Affinity-Style Summary",
"maps_to": "boltz_boltz2_affinity_predictor.affinity_summary",
"description": "Parsed Boltz-2 affinity outputs, including binder probability and predicted affinity-like value when emitted."
},
{
"name": "confidence_summary",
"label": "Structure Confidence Summary",
"maps_to": "boltz_boltz2_affinity_predictor.confidence_summary",
"description": "Parsed Boltz-2 confidence outputs for the top-ranked predicted complex."
},
{
"name": "structure_artifacts",
"label": "Predicted Complex Structure Artifacts",
"maps_to": "boltz_boltz2_affinity_predictor.structure_artifacts",
"description": "File-backed structure artifacts, usually mmCIF, used by the 3D structure visualisation."
},
{
"name": "run_metadata",
"label": "Boltz Run Metadata",
"maps_to": "boltz_boltz2_affinity_predictor.run_metadata",
"description": "Runtime status, command metadata, logs, and caveats for the latest Boltz invocation."
}
]
},
"tags": [
"docking",
"boltz",
"structural-biology",
"protein-ligand",
"affinity",
"gpu"
],
"title": "Boltz: Boltz2AffinityPredictor Lab",
"models": [
{
"path": "models/core",
"alias": "boltz_boltz2_affinity_predictor",
"parameters": {
"override": true,
"accelerator": "gpu",
"runtime_mode": "managed",
"output_format": "mmcif",
"sampling_steps": 200,
"use_msa_server": true,
"recycling_steps": 3,
"diffusion_samples": 1,
"default_ligand_smiles": "N[C@@H](Cc1ccc(O)cc1)C(=O)O",
"default_protein_sequence": "MVTPEGNVSLVDESLLVGVTDEDRAVRSAHQFYERLIGLWAPAVMEAAHELGVFAALAEAPADSGELARRLDCDARAMRVLLDALYAYDVIDRIHDTNGFRYLLSAEARECLLPGTLFSLVGKFMHDINVAWPAWRNLAEVVRHGARDTSGAESPNGIAQEDYESLVGGINFWAPPIVTTLSRKLRASGRSGDATASVLDVGCGTGLYSQLLLREFPRWTATGLDVERIATLANAQALRLGVEERFATRAGDFWRGGWGTGYDLVLFANIFHLQTPASAVRLMRHAAACLAPDGLVAVVDQIVDADREPKTPQDRFALLFAASMTNTGGGDAYTFQEYEEWFTAAGLQRIETLDTPMHRILLARRATEPSAVPEGQASENLYFQ"
}
},
{
"path": "models/visualisation",
"alias": "visualisation",
"parameters": {
"integration_step": 0.01
}
}
],
"wiring": [
{
"to": [
"visualisation.boltz_boltz2_affinity_predictor_affinity_summary"
],
"from": "boltz_boltz2_affinity_predictor.affinity_summary"
},
{
"to": [
"visualisation.boltz_boltz2_affinity_predictor_confidence_summary"
],
"from": "boltz_boltz2_affinity_predictor.confidence_summary"
},
{
"to": [
"visualisation.boltz_boltz2_affinity_predictor_structure_artifacts"
],
"from": "boltz_boltz2_affinity_predictor.structure_artifacts"
},
{
"to": [
"visualisation.boltz_boltz2_affinity_predictor_run_metadata"
],
"from": "boltz_boltz2_affinity_predictor.run_metadata"
}
],
"package": "boltz-boltz2-affinity-predictor",
"runtime": {
"duration": 0.01,
"settle_steps": 1,
"initial_inputs": {},
"python_version": "3.10",
"communication_step": 0.01
},
"version": "1.0.0",
"description": "Multi-model lab with an embedded visualisation sibling for Boltz-2 affinity-focused protein-ligand predictions. Ships with a real protein/ligand pair so the lab runs out of the box on a GPU runner.",
"schema_version": "2.0"
}Sign in to start your own run. Public-lab history stays visible here.
Select a run from History to view its results.